C15H16F3NO3S2 — CID 166174690
N-tert-butyl-5-[3-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide (PubChem CID 166174690) has the molecular formula C15H16F3NO3S2 and a molecular weight of 379.43 g/mol. Its IUPAC name is N-tert-butyl-5-[3-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-tert-butyl-5-[3-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 166174690 |
| Molecular Formula | C15H16F3NO3S2 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-tert-butyl-5-[3-(trifluoromethoxy)phenyl]thiophene-2-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(-c2cccc(OC(F)(F)F)c2)s1 |
| InChI | InChI=1S/C15H16F3NO3S2/c1-14(2,3)19-24(20,21)13-8-7-12(23-13)10-5-4-6-11(9-10)22-15(16,17)18/h4-9,19H,1-3H3 |
| InChIKey | ABDQHSAMXKEVAL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |