C13H9ClF3NO3S — CID 134626076
2-chloro-4-[3-(trifluoromethoxy)phenyl]benzenesulfonamide (PubChem CID 134626076) has the molecular formula C13H9ClF3NO3S and a molecular weight of 351.73 g/mol. Its IUPAC name is 2-chloro-4-[3-(trifluoromethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2-chloro-4-[3-(trifluoromethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134626076 |
| Molecular Formula | C13H9ClF3NO3S |
| Molecular Weight | 351.73 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2-chloro-4-[3-(trifluoromethoxy)phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cccc(OC(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C13H9ClF3NO3S/c14-11-7-9(4-5-12(11)22(18,19)20)8-2-1-3-10(6-8)21-13(15,16)17/h1-7H,(H2,18,19,20) |
| InChIKey | WNGRKHUKJSKSBH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |