C19H15F3N2O4S2 — CID 143826022
2-[[3-[3-(trifluoromethoxy)phenyl]phenyl]sulfinylamino]benzenesulfonamide (PubChem CID 143826022) has the molecular formula C19H15F3N2O4S2 and a molecular weight of 456.47 g/mol. Its IUPAC name is 2-[[3-[3-(trifluoromethoxy)phenyl]phenyl]sulfinylamino]benzenesulfonamide.
| Compound Name | 2-[[3-[3-(trifluoromethoxy)phenyl]phenyl]sulfinylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 143826022 |
| Molecular Formula | C19H15F3N2O4S2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 2-[[3-[3-(trifluoromethoxy)phenyl]phenyl]sulfinylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1NS(=O)c1cccc(-c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H15F3N2O4S2/c20-19(21,22)28-15-7-3-5-13(11-15)14-6-4-8-16(12-14)29(25)24-17-9-1-2-10-18(17)30(23,26)27/h1-12,24H,(H2,23,26,27) |
| InChIKey | CIAPJCWSIPXXOS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |