C19H11F6NO2 — CID 134623402
3,5-bis[3-(trifluoromethoxy)phenyl]pyridine (PubChem CID 134623402) has the molecular formula C19H11F6NO2 and a molecular weight of 399.29 g/mol. Its IUPAC name is 3,5-bis[3-(trifluoromethoxy)phenyl]pyridine.
| Compound Name | 3,5-bis[3-(trifluoromethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 134623402 |
| Molecular Formula | C19H11F6NO2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 3,5-bis[3-(trifluoromethoxy)phenyl]pyridine |
| SMILES | FC(F)(F)Oc1cccc(-c2cncc(-c3cccc(OC(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C19H11F6NO2/c20-18(21,22)27-16-5-1-3-12(8-16)14-7-15(11-26-10-14)13-4-2-6-17(9-13)28-19(23,24)25/h1-11H |
| InChIKey | GWSJXBOXRIHMAT-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |