C20H10F9NO2 — CID 134622968
3,4-bis[3-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine (PubChem CID 134622968) has the molecular formula C20H10F9NO2 and a molecular weight of 467.29 g/mol. Its IUPAC name is 3,4-bis[3-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3,4-bis[3-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134622968 |
| Molecular Formula | C20H10F9NO2 |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 3,4-bis[3-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)Oc1cccc(-c2cncc(C(F)(F)F)c2-c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H10F9NO2/c21-18(22,23)16-10-30-9-15(11-3-1-5-13(7-11)31-19(24,25)26)17(16)12-4-2-6-14(8-12)32-20(27,28)29/h1-10H |
| InChIKey | VCIJWWLRUASPOH-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |