C17H22O3S — CID 134877618
2-[hydroxy-[1-(2-methoxyphenyl)sulfanylcyclopropyl]methyl]cyclohexan-1-one (PubChem CID 134877618) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-[hydroxy-[1-(2-methoxyphenyl)sulfanylcyclopropyl]methyl]cyclohexan-1-one.
| Compound Name | 2-[hydroxy-[1-(2-methoxyphenyl)sulfanylcyclopropyl]methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 134877618 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-[hydroxy-[1-(2-methoxyphenyl)sulfanylcyclopropyl]methyl]cyclohexan-1-one |
| SMILES | COc1ccccc1SC1(C(O)C2CCCCC2=O)CC1 |
| InChI | InChI=1S/C17H22O3S/c1-20-14-8-4-5-9-15(14)21-17(10-11-17)16(19)12-6-2-3-7-13(12)18/h4-5,8-9,12,16,19H,2-3,6-7,10-11H2,1H3 |
| InChIKey | GYQKREKNCWCURN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |