C14H10F6O2 — CID 71502066
2-[3,5-bis(trifluoromethyl)benzoyl]cyclopentan-1-one (PubChem CID 71502066) has the molecular formula C14H10F6O2 and a molecular weight of 324.22 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzoyl]cyclopentan-1-one.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzoyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 71502066 |
| Molecular Formula | C14H10F6O2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzoyl]cyclopentan-1-one |
| SMILES | O=C1CCCC1C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F6O2/c15-13(16,17)8-4-7(5-9(6-8)14(18,19)20)12(22)10-2-1-3-11(10)21/h4-6,10H,1-3H2 |
| InChIKey | VVMKXJWMPVQZFR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|