C17H22O5 — CID 154083856
2-(3,4,5-trimethoxybenzoyl)cycloheptan-1-one (PubChem CID 154083856) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxybenzoyl)cycloheptan-1-one.
| Compound Name | 2-(3,4,5-trimethoxybenzoyl)cycloheptan-1-one |
|---|---|
| PubChem CID | 154083856 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-(3,4,5-trimethoxybenzoyl)cycloheptan-1-one |
| SMILES | COc1cc(C(=O)C2CCCCCC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H22O5/c1-20-14-9-11(10-15(21-2)17(14)22-3)16(19)12-7-5-4-6-8-13(12)18/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | URJCLTJWGBGZCE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|