C18H27NO4 — CID 2452744
2-[cyclohexyl(methyl)amino]-1-(3,4,5-trimethoxyphenyl)ethanone (PubChem CID 2452744) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[cyclohexyl(methyl)amino]-1-(3,4,5-trimethoxyphenyl)ethanone.
| Compound Name | 2-[cyclohexyl(methyl)amino]-1-(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 2452744 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-[cyclohexyl(methyl)amino]-1-(3,4,5-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(C(=O)CN(C)C2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H27NO4/c1-19(14-8-6-5-7-9-14)12-15(20)13-10-16(21-2)18(23-4)17(11-13)22-3/h10-11,14H,5-9,12H2,1-4H3 |
| InChIKey | PWWVMRBRRCCYJE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |