C17H24BrNO2 — CID 60681492
1-(3-bromo-4-methoxyphenyl)-2-[methyl-(4-methylcyclohexyl)amino]ethanone (PubChem CID 60681492) has the molecular formula C17H24BrNO2 and a molecular weight of 354.29 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-2-[methyl-(4-methylcyclohexyl)amino]ethanone.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-2-[methyl-(4-methylcyclohexyl)amino]ethanone |
|---|---|
| PubChem CID | 60681492 |
| Molecular Formula | C17H24BrNO2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-2-[methyl-(4-methylcyclohexyl)amino]ethanone |
| SMILES | COc1ccc(C(=O)CN(C)C2CCC(C)CC2)cc1Br |
| InChI | InChI=1S/C17H24BrNO2/c1-12-4-7-14(8-5-12)19(2)11-16(20)13-6-9-17(21-3)15(18)10-13/h6,9-10,12,14H,4-5,7-8,11H2,1-3H3 |
| InChIKey | IAGWVJWOIQGDOW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |