C18H25N3O6 — CID 7438743
(3S)-2-oxo-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]piperidine-3-carboxamide (PubChem CID 7438743) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is (3S)-2-oxo-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]piperidine-3-carboxamide.
| Compound Name | (3S)-2-oxo-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 7438743 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (3S)-2-oxo-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]piperidine-3-carboxamide |
| SMILES | COc1cc(C(=O)NCCNC(=O)[C@H]2CCCNC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H25N3O6/c1-25-13-9-11(10-14(26-2)15(13)27-3)16(22)20-7-8-21-18(24)12-5-4-6-19-17(12)23/h9-10,12H,4-8H2,1-3H3,(H,19,23)(H,20,22)(H,21,24)/t12-/m0/s1 |
| InChIKey | LHJVSFYFKJBHRT-LBPRGKRZSA-N |
| XLogP | 0.08 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|