C17H19F3O2S — CID 171942736
[3-methoxy-5-(trifluoromethyl)phenyl]-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171942736) has the molecular formula C17H19F3O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is [3-methoxy-5-(trifluoromethyl)phenyl]-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | [3-methoxy-5-(trifluoromethyl)phenyl]-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171942736 |
| Molecular Formula | C17H19F3O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [3-methoxy-5-(trifluoromethyl)phenyl]-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | COc1cc(C(=O)C2CC3CCCC(C2)S3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19F3O2S/c1-22-13-6-10(5-12(9-13)17(18,19)20)16(21)11-7-14-3-2-4-15(8-11)23-14/h5-6,9,11,14-15H,2-4,7-8H2,1H3 |
| InChIKey | LVPFRDNXCOFNJL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |