C16H17F3OS — CID 171941524
9-thiabicyclo[3.3.1]nonan-3-yl-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 171941524) has the molecular formula C16H17F3OS and a molecular weight of 314.37 g/mol. Its IUPAC name is 9-thiabicyclo[3.3.1]nonan-3-yl-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | 9-thiabicyclo[3.3.1]nonan-3-yl-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 171941524 |
| Molecular Formula | C16H17F3OS |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 9-thiabicyclo[3.3.1]nonan-3-yl-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)C1CC2CCCC(C1)S2 |
| InChI | InChI=1S/C16H17F3OS/c17-16(18,19)14-7-2-1-6-13(14)15(20)10-8-11-4-3-5-12(9-10)21-11/h1-2,6-7,10-12H,3-5,8-9H2 |
| InChIKey | GZCIHIFJVGDLHO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |