C20H22O2S — CID 171943186
(4-methoxynaphthalen-1-yl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171943186) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is (4-methoxynaphthalen-1-yl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | (4-methoxynaphthalen-1-yl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171943186 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (4-methoxynaphthalen-1-yl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | COc1ccc(C(=O)C2CC3CCCC(C2)S3)c2ccccc12 |
| InChI | InChI=1S/C20H22O2S/c1-22-19-10-9-18(16-7-2-3-8-17(16)19)20(21)13-11-14-5-4-6-15(12-13)23-14/h2-3,7-10,13-15H,4-6,11-12H2,1H3 |
| InChIKey | DLRARHSYXRQERE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |