C16H19FO2S — CID 171947293
(2-fluoro-6-methoxyphenyl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171947293) has the molecular formula C16H19FO2S and a molecular weight of 294.39 g/mol. Its IUPAC name is (2-fluoro-6-methoxyphenyl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | (2-fluoro-6-methoxyphenyl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171947293 |
| Molecular Formula | C16H19FO2S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (2-fluoro-6-methoxyphenyl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | COc1cccc(F)c1C(=O)C1CC2CCCC(C1)S2 |
| InChI | InChI=1S/C16H19FO2S/c1-19-14-7-3-6-13(17)15(14)16(18)10-8-11-4-2-5-12(9-10)20-11/h3,6-7,10-12H,2,4-5,8-9H2,1H3 |
| InChIKey | WKJZZFAOGRVNFY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |