C16H18F2O2S — CID 171940487
[3-(difluoromethoxy)phenyl]-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171940487) has the molecular formula C16H18F2O2S and a molecular weight of 312.38 g/mol. Its IUPAC name is [3-(difluoromethoxy)phenyl]-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | [3-(difluoromethoxy)phenyl]-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171940487 |
| Molecular Formula | C16H18F2O2S |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [3-(difluoromethoxy)phenyl]-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | O=C(c1cccc(OC(F)F)c1)C1CC2CCCC(C1)S2 |
| InChI | InChI=1S/C16H18F2O2S/c17-16(18)20-12-4-1-3-10(7-12)15(19)11-8-13-5-2-6-14(9-11)21-13/h1,3-4,7,11,13-14,16H,2,5-6,8-9H2 |
| InChIKey | UNSIDXMGBDSNFY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |