(2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate

C13H14F2O3 — CID 86889974

IUPAC(2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate
SMILESCC1CC1COC(=O)c1cccc(OC(F)F)c1
InChIInChI=1S/C13H14F2O3/c1-8-5-10(8)7-17-12(16)9-3-2-4-11(6-9)18-13(14)15/h2-4,6,8,10,13H,5,7H2,1H3
InChIKeyQBVXUBSLFUJGKA-UHFFFAOYSA-N
MW256.25 g/mol
LogP3.10
Rot. Bonds5

About (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate

(2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate (PubChem CID 86889974) has the molecular formula C13H14F2O3 and a molecular weight of 256.25 g/mol. Its IUPAC name is (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate.

Molecular Properties

Compound Name(2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate
PubChem CID86889974
Molecular FormulaC13H14F2O3
Molecular Weight256.25 g/mol
Exact Mass256.09
IUPAC Name(2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate
SMILESCC1CC1COC(=O)c1cccc(OC(F)F)c1
InChIInChI=1S/C13H14F2O3/c1-8-5-10(8)7-17-12(16)9-3-2-4-11(6-9)18-13(14)15/h2-4,6,8,10,13H,5,7H2,1H3
InChIKeyQBVXUBSLFUJGKA-UHFFFAOYSA-N
XLogP3.10
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.25
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate?
The IUPAC name of (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate (CID 86889974) is (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate.
What is the SMILES notation for (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate?
The canonical SMILES for (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate is CC1CC1COC(=O)c1cccc(OC(F)F)c1.
What is the InChIKey of (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate?
The InChIKey is QBVXUBSLFUJGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2O3/c1-8-5-10(8)7-17-12(16)9-3-2-4-11(6-9)18-13(14)15/h2-4,6,8,10,13H,5,7H2,1H3.
What are the key properties of (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate?
(2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate has a molecular weight of 256.25 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclopropyl)methyl 3-(difluoromethoxy)benzoate is sourced from PubChem (CID 86889974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).