C27H23N3O3S — CID 139603379
[1-(benzenesulfonyl)-3-(2-pyridin-2-ylethyl)indol-2-yl]-pyridin-4-ylmethanol (PubChem CID 139603379) has the molecular formula C27H23N3O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-3-(2-pyridin-2-ylethyl)indol-2-yl]-pyridin-4-ylmethanol.
| Compound Name | [1-(benzenesulfonyl)-3-(2-pyridin-2-ylethyl)indol-2-yl]-pyridin-4-ylmethanol |
|---|---|
| PubChem CID | 139603379 |
| Molecular Formula | C27H23N3O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | [1-(benzenesulfonyl)-3-(2-pyridin-2-ylethyl)indol-2-yl]-pyridin-4-ylmethanol |
| SMILES | O=S(=O)(c1ccccc1)n1c(C(O)c2ccncc2)c(CCc2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C27H23N3O3S/c31-27(20-15-18-28-19-16-20)26-24(14-13-21-8-6-7-17-29-21)23-11-4-5-12-25(23)30(26)34(32,33)22-9-2-1-3-10-22/h1-12,15-19,27,31H,13-14H2 |
| InChIKey | BODIUKGQBJBKMC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |