About [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone
[1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone (PubChem CID 67036009) has the molecular formula C24H22N2O5S
and a molecular weight of 450.52 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone.
Molecular Properties
| Compound Name | [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone |
| PubChem CID | 67036009 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone |
| SMILES | CCOc1cccc2c1c(OCC)c(C(=O)c1ccccn1)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O5S/c1-3-30-20-15-10-14-19-21(20)24(31-4-2)22(23(27)18-13-8-9-16-25-18)26(19)32(28,29)17-11-6-5-7-12-17/h5-16H,3-4H2,1-2H3 |
| InChIKey | UMEBXGPYLUWSIW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone?
The IUPAC name of [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone (CID 67036009) is [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone.
What is the SMILES notation for [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone?
The canonical SMILES for [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone is CCOc1cccc2c1c(OCC)c(C(=O)c1ccccn1)n2S(=O)(=O)c1ccccc1.
What is the InChIKey of [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone?
The InChIKey is UMEBXGPYLUWSIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O5S/c1-3-30-20-15-10-14-19-21(20)24(31-4-2)22(23(27)18-13-8-9-16-25-18)26(19)32(28,29)17-11-6-5-7-12-17/h5-16H,3-4H2,1-2H3.
What are the key properties of [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone?
[1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone has a molecular weight of 450.52 g/mol, XLogP of 4.30, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(benzenesulfonyl)-3,4-diethoxyindol-2-yl]-pyridin-2-ylmethanone is sourced from PubChem (CID 67036009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).