C20H16N2O4S2 — CID 134907002
ethyl 1-(benzenesulfonyl)-3-(1,3-thiazol-2-yl)indole-2-carboxylate (PubChem CID 134907002) has the molecular formula C20H16N2O4S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is ethyl 1-(benzenesulfonyl)-3-(1,3-thiazol-2-yl)indole-2-carboxylate.
| Compound Name | ethyl 1-(benzenesulfonyl)-3-(1,3-thiazol-2-yl)indole-2-carboxylate |
|---|---|
| PubChem CID | 134907002 |
| Molecular Formula | C20H16N2O4S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | ethyl 1-(benzenesulfonyl)-3-(1,3-thiazol-2-yl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2nccs2)c2ccccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O4S2/c1-2-26-20(23)18-17(19-21-12-13-27-19)15-10-6-7-11-16(15)22(18)28(24,25)14-8-4-3-5-9-14/h3-13H,2H2,1H3 |
| InChIKey | ZIOHCSUGOQERGT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |