C20H18BrNO4S — CID 10253077
ethyl (E)-3-[1-(benzenesulfonyl)-2-(bromomethyl)indol-3-yl]prop-2-enoate (PubChem CID 10253077) has the molecular formula C20H18BrNO4S and a molecular weight of 448.34 g/mol. Its IUPAC name is ethyl (E)-3-[1-(benzenesulfonyl)-2-(bromomethyl)indol-3-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[1-(benzenesulfonyl)-2-(bromomethyl)indol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10253077 |
| Molecular Formula | C20H18BrNO4S |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | ethyl (E)-3-[1-(benzenesulfonyl)-2-(bromomethyl)indol-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(CBr)n(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C20H18BrNO4S/c1-2-26-20(23)13-12-17-16-10-6-7-11-18(16)22(19(17)14-21)27(24,25)15-8-4-3-5-9-15/h3-13H,2,14H2,1H3/b13-12+ |
| InChIKey | NENNWKILUMYVBW-OUKQBFOZSA-N |
| XLogP | 4.35 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|