C28H24N4O4S2 — CID 69081244
1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (PubChem CID 69081244) has the molecular formula C28H24N4O4S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
| Compound Name | 1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 69081244 |
| Molecular Formula | C28H24N4O4S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3cccnc32)cc1.Cc1ccc(S(=O)(=O)n2ccc3cccnc32)cc1 |
| InChI | InChI=1S/2C14H12N2O2S/c2*1-11-4-6-13(7-5-11)19(17,18)16-10-8-12-3-2-9-15-14(12)16/h2*2-10H,1H3 |
| InChIKey | DEPDUCAGVHFHKX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 103.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |