C13H10IN3O2S — CID 58691740
4-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine (PubChem CID 58691740) has the molecular formula C13H10IN3O2S and a molecular weight of 399.21 g/mol. Its IUPAC name is 4-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 58691740 |
| Molecular Formula | C13H10IN3O2S |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 4-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(I)ncnc32)cc1 |
| InChI | InChI=1S/C13H10IN3O2S/c1-9-2-4-10(5-3-9)20(18,19)17-7-6-11-12(14)15-8-16-13(11)17/h2-8H,1H3 |
| InChIKey | KLDSFRZUPGWQCX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|