C15H12BrN3O3S — CID 58691725
2-bromo-1-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]ethanone (PubChem CID 58691725) has the molecular formula C15H12BrN3O3S and a molecular weight of 394.25 g/mol. Its IUPAC name is 2-bromo-1-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]ethanone.
| Compound Name | 2-bromo-1-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]ethanone |
|---|---|
| PubChem CID | 58691725 |
| Molecular Formula | C15H12BrN3O3S |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 2-bromo-1-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]ethanone |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(C(=O)CBr)ncnc32)cc1 |
| InChI | InChI=1S/C15H12BrN3O3S/c1-10-2-4-11(5-3-10)23(21,22)19-7-6-12-14(13(20)8-16)17-9-18-15(12)19/h2-7,9H,8H2,1H3 |
| InChIKey | XXORBQPLLSRELZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|