C19H21IN4O2S — CID 118868826
N-[3-(iodomethyl)cyclobutyl]-N-methyl-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 118868826) has the molecular formula C19H21IN4O2S and a molecular weight of 496.37 g/mol. Its IUPAC name is N-[3-(iodomethyl)cyclobutyl]-N-methyl-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[3-(iodomethyl)cyclobutyl]-N-methyl-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118868826 |
| Molecular Formula | C19H21IN4O2S |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | N-[3-(iodomethyl)cyclobutyl]-N-methyl-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(N(C)C4CC(CI)C4)ncnc32)cc1 |
| InChI | InChI=1S/C19H21IN4O2S/c1-13-3-5-16(6-4-13)27(25,26)24-8-7-17-18(21-12-22-19(17)24)23(2)15-9-14(10-15)11-20/h3-8,12,14-15H,9-11H2,1-2H3 |
| InChIKey | OMJTYCUHYIRHTK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|