C21H26N4O4S2 — CID 66636508
[4-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]methanesulfinic acid (PubChem CID 66636508) has the molecular formula C21H26N4O4S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is [4-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]methanesulfinic acid.
| Compound Name | [4-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]methanesulfinic acid |
|---|---|
| PubChem CID | 66636508 |
| Molecular Formula | C21H26N4O4S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [4-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]methanesulfinic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(N(C)C4CCC(CS(=O)O)CC4)ncnc32)cc1 |
| InChI | InChI=1S/C21H26N4O4S2/c1-15-3-9-18(10-4-15)31(28,29)25-12-11-19-20(22-14-23-21(19)25)24(2)17-7-5-16(6-8-17)13-30(26)27/h3-4,9-12,14,16-17H,5-8,13H2,1-2H3,(H,26,27) |
| InChIKey | JJGAPISDIYQLJX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|