C19H22N4O2SZn — CID 139484459
N-methyl-N-(3-methylcyclobutyl)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine;zinc (PubChem CID 139484459) has the molecular formula C19H22N4O2SZn and a molecular weight of 435.87 g/mol. Its IUPAC name is N-methyl-N-(3-methylcyclobutyl)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine;zinc.
| Compound Name | N-methyl-N-(3-methylcyclobutyl)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine;zinc |
|---|---|
| PubChem CID | 139484459 |
| Molecular Formula | C19H22N4O2SZn |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-methyl-N-(3-methylcyclobutyl)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine;zinc |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(N(C)C4CC(C)C4)ncnc32)cc1.[Zn] |
| InChI | InChI=1S/C19H22N4O2S.Zn/c1-13-4-6-16(7-5-13)26(24,25)23-9-8-17-18(20-12-21-19(17)23)22(3)15-10-14(2)11-15;/h4-9,12,14-15H,10-11H2,1-3H3; |
| InChIKey | CQPUWCGUUZBGFM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|