C22H28N4O5S2 — CID 76743942
[3-methyl-4-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonic acid (PubChem CID 76743942) has the molecular formula C22H28N4O5S2 and a molecular weight of 492.62 g/mol. Its IUPAC name is [3-methyl-4-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonic acid.
| Compound Name | [3-methyl-4-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonic acid |
|---|---|
| PubChem CID | 76743942 |
| Molecular Formula | C22H28N4O5S2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [3-methyl-4-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(N(C)C4CCC(CS(=O)(=O)O)CC4C)ncnc32)cc1 |
| InChI | InChI=1S/C22H28N4O5S2/c1-15-4-7-18(8-5-15)33(30,31)26-11-10-19-21(23-14-24-22(19)26)25(3)20-9-6-17(12-16(20)2)13-32(27,28)29/h4-5,7-8,10-11,14,16-17,20H,6,9,12-13H2,1-3H3,(H,27,28,29) |
| InChIKey | LAEOQRFNMGETKK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|