C22H23N7O3S — CID 164822067
(NE)-N-[[6-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]methylidene]hydroxylamine (PubChem CID 164822067) has the molecular formula C22H23N7O3S and a molecular weight of 465.54 g/mol. Its IUPAC name is (NE)-N-[[6-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[6-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 164822067 |
| Molecular Formula | C22H23N7O3S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (NE)-N-[[6-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]methylidene]hydroxylamine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(N(C)C4CCc5cc(/C=N/O)nn5C4)ncnc32)cc1 |
| InChI | InChI=1S/C22H23N7O3S/c1-15-3-7-19(8-4-15)33(31,32)29-10-9-20-21(23-14-24-22(20)29)27(2)18-6-5-17-11-16(12-25-30)26-28(17)13-18/h3-4,7-12,14,18,30H,5-6,13H2,1-2H3/b25-12+ |
| InChIKey | FXHJXGLYYBWWAV-BRJLIKDPSA-N |
| XLogP | 2.43 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|