C14H12BrN3O2S — CID 67078609
5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-amine (PubChem CID 67078609) has the molecular formula C14H12BrN3O2S and a molecular weight of 366.24 g/mol. Its IUPAC name is 5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 67078609 |
| Molecular Formula | C14H12BrN3O2S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-amine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(N)c(Br)cnc32)cc1 |
| InChI | InChI=1S/C14H12BrN3O2S/c1-9-2-4-10(5-3-9)21(19,20)18-7-6-11-13(16)12(15)8-17-14(11)18/h2-8H,1H3,(H2,16,17) |
| InChIKey | HRUZEGDRHISTDQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |