C19H20N4O3S — CID 86708840
(E)-1-[5-amino-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]-3-(dimethylamino)prop-2-en-1-one (PubChem CID 86708840) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is (E)-1-[5-amino-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]-3-(dimethylamino)prop-2-en-1-one.
| Compound Name | (E)-1-[5-amino-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]-3-(dimethylamino)prop-2-en-1-one |
|---|---|
| PubChem CID | 86708840 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (E)-1-[5-amino-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]-3-(dimethylamino)prop-2-en-1-one |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(C(=O)/C=C/N(C)C)c(N)cnc32)cc1 |
| InChI | InChI=1S/C19H20N4O3S/c1-13-4-6-14(7-5-13)27(25,26)23-11-8-15-18(16(20)12-21-19(15)23)17(24)9-10-22(2)3/h4-12H,20H2,1-3H3/b10-9+ |
| InChIKey | KGVYYCIIRICFJO-MDZDMXLPSA-N |
| XLogP | 2.42 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|