C13H10B2ClN3O2S- — CID 164970592
CID 164970592 (PubChem CID 164970592) has the molecular formula C13H10B2ClN3O2S- and a molecular weight of 329.39 g/mol.
| Compound Name | CID 164970592 |
|---|---|
| PubChem CID | 164970592 |
| Molecular Formula | C13H10B2ClN3O2S- |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(Cl)ncnc32)cc1.[B][B-] |
| InChI | InChI=1S/C13H10ClN3O2S.B2/c1-9-2-4-10(5-3-9)20(18,19)17-7-6-11-12(14)15-8-16-13(11)17;1-2/h2-8H,1H3;/q;-1 |
| InChIKey | QPTAJUDBZFISHE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|