C14H14N4O2S — CID 177039469
1-(benzenesulfonyl)-4-N-methylpyrrolo[2,3-b]pyridine-4,5-diamine (PubChem CID 177039469) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-N-methylpyrrolo[2,3-b]pyridine-4,5-diamine.
| Compound Name | 1-(benzenesulfonyl)-4-N-methylpyrrolo[2,3-b]pyridine-4,5-diamine |
|---|---|
| PubChem CID | 177039469 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1-(benzenesulfonyl)-4-N-methylpyrrolo[2,3-b]pyridine-4,5-diamine |
| SMILES | CNc1c(N)cnc2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14N4O2S/c1-16-13-11-7-8-18(14(11)17-9-12(13)15)21(19,20)10-5-3-2-4-6-10/h2-9H,15H2,1H3,(H,16,17) |
| InChIKey | ONQINZZJBRZUCK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |