C25H36N4O3SSi — CID 131730634
1-(benzenesulfonyl)-4-N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pyrrolo[2,3-b]pyridine-4,5-diamine (PubChem CID 131730634) has the molecular formula C25H36N4O3SSi and a molecular weight of 500.74 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pyrrolo[2,3-b]pyridine-4,5-diamine.
| Compound Name | 1-(benzenesulfonyl)-4-N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pyrrolo[2,3-b]pyridine-4,5-diamine |
|---|---|
| PubChem CID | 131730634 |
| Molecular Formula | C25H36N4O3SSi |
| Molecular Weight | 500.74 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 1-(benzenesulfonyl)-4-N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pyrrolo[2,3-b]pyridine-4,5-diamine |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(Nc2c(N)cnc3c2ccn3S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H36N4O3SSi/c1-25(2,3)34(4,5)32-19-13-11-18(12-14-19)28-23-21-15-16-29(24(21)27-17-22(23)26)33(30,31)20-9-7-6-8-10-20/h6-10,15-19H,11-14,26H2,1-5H3,(H,27,28) |
| InChIKey | BXJMMTWMCXZUFJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.74 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|