C18H19N4O4S- — CID 170206885
N-[1-(benzenesulfonyl)-4-(cyclopentylamino)pyrrolo[2,3-b]pyridin-5-yl]-N-oxidohydroxylamine (PubChem CID 170206885) has the molecular formula C18H19N4O4S- and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[1-(benzenesulfonyl)-4-(cyclopentylamino)pyrrolo[2,3-b]pyridin-5-yl]-N-oxidohydroxylamine.
| Compound Name | N-[1-(benzenesulfonyl)-4-(cyclopentylamino)pyrrolo[2,3-b]pyridin-5-yl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 170206885 |
| Molecular Formula | C18H19N4O4S- |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[1-(benzenesulfonyl)-4-(cyclopentylamino)pyrrolo[2,3-b]pyridin-5-yl]-N-oxidohydroxylamine |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2c(NC3CCCC3)c(N([O-])O)cnc21 |
| InChI | InChI=1S/C18H19N4O4S/c23-22(24)16-12-19-18-15(17(16)20-13-6-4-5-7-13)10-11-21(18)27(25,26)14-8-2-1-3-9-14/h1-3,8-13,23H,4-7H2,(H,19,20)/q-1 |
| InChIKey | TXTXYCJRRPDJPA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|