C19H12ClN5O3S — CID 68522082
17-chloro-14-(4-methylphenyl)sulfonyl-1,4,9,14,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12,16-heptaen-2-one (PubChem CID 68522082) has the molecular formula C19H12ClN5O3S and a molecular weight of 425.86 g/mol. Its IUPAC name is 17-chloro-14-(4-methylphenyl)sulfonyl-1,4,9,14,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12,16-heptaen-2-one.
| Compound Name | 17-chloro-14-(4-methylphenyl)sulfonyl-1,4,9,14,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12,16-heptaen-2-one |
|---|---|
| PubChem CID | 68522082 |
| Molecular Formula | C19H12ClN5O3S |
| Molecular Weight | 425.86 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 17-chloro-14-(4-methylphenyl)sulfonyl-1,4,9,14,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12,16-heptaen-2-one |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2nc(Cl)n2c(=O)c4ncccc4nc32)cc1 |
| InChI | InChI=1S/C19H12ClN5O3S/c1-11-4-6-12(7-5-11)29(27,28)24-10-8-13-16(24)23-19(20)25-17(13)22-14-3-2-9-21-15(14)18(25)26/h2-10H,1H3 |
| InChIKey | UKJHMCJGJPILSD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.86 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|