C13H15NO2S — CID 102326520
2,3-dimethyl-1-(4-methylphenyl)sulfonylpyrrole (PubChem CID 102326520) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 2,3-dimethyl-1-(4-methylphenyl)sulfonylpyrrole.
| Compound Name | 2,3-dimethyl-1-(4-methylphenyl)sulfonylpyrrole |
|---|---|
| PubChem CID | 102326520 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2,3-dimethyl-1-(4-methylphenyl)sulfonylpyrrole |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc(C)c2C)cc1 |
| InChI | InChI=1S/C13H15NO2S/c1-10-4-6-13(7-5-10)17(15,16)14-9-8-11(2)12(14)3/h4-9H,1-3H3 |
| InChIKey | GMZKPBOFRHRQJT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |