C23H27NO5S — CID 102392777
tert-butyl 1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-oxo-3H-indene-1-carboxylate (PubChem CID 102392777) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is tert-butyl 1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-oxo-3H-indene-1-carboxylate.
| Compound Name | tert-butyl 1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-oxo-3H-indene-1-carboxylate |
|---|---|
| PubChem CID | 102392777 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | tert-butyl 1-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-oxo-3H-indene-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)NCCC2(C(=O)OC(C)(C)C)C(=O)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C23H27NO5S/c1-16-9-11-18(12-10-16)30(27,28)24-14-13-23(21(26)29-22(2,3)4)19-8-6-5-7-17(19)15-20(23)25/h5-12,24H,13-15H2,1-4H3 |
| InChIKey | BFYINXZEWVUFSX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|