C26H34N2O7S — CID 135029766
tert-butyl (3R,3'S,4S)-3,3',4-trihydroxy-3'-[2-[(4-methylphenyl)sulfonylamino]ethyl]spiro[cyclopentane-1,2'-indole]-1'-carboxylate (PubChem CID 135029766) has the molecular formula C26H34N2O7S and a molecular weight of 518.63 g/mol. Its IUPAC name is tert-butyl (3R,3'S,4S)-3,3',4-trihydroxy-3'-[2-[(4-methylphenyl)sulfonylamino]ethyl]spiro[cyclopentane-1,2'-indole]-1'-carboxylate.
| Compound Name | tert-butyl (3R,3'S,4S)-3,3',4-trihydroxy-3'-[2-[(4-methylphenyl)sulfonylamino]ethyl]spiro[cyclopentane-1,2'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 135029766 |
| Molecular Formula | C26H34N2O7S |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | tert-butyl (3R,3'S,4S)-3,3',4-trihydroxy-3'-[2-[(4-methylphenyl)sulfonylamino]ethyl]spiro[cyclopentane-1,2'-indole]-1'-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)NCC[C@]2(O)c3ccccc3N(C(=O)OC(C)(C)C)C23C[C@@H](O)[C@@H](O)C3)cc1 |
| InChI | InChI=1S/C26H34N2O7S/c1-17-9-11-18(12-10-17)36(33,34)27-14-13-26(32)19-7-5-6-8-20(19)28(23(31)35-24(2,3)4)25(26)15-21(29)22(30)16-25/h5-12,21-22,27,29-30,32H,13-16H2,1-4H3/t21-,22+,25?,26-/m0/s1 |
| InChIKey | GWLXTTZAGKBQND-ZILGMKCBSA-N |
| XLogP | 2.56 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |