C31H47N3O6S — CID 170605775
tert-butyl 7-[[4-[3-[(4-methylphenyl)sulfonylamino]propylidene]cyclohexyl]oxymethyl]-2-oxo-1,8-diazaspiro[5.5]undecane-8-carboxylate (PubChem CID 170605775) has the molecular formula C31H47N3O6S and a molecular weight of 589.80 g/mol. Its IUPAC name is tert-butyl 7-[[4-[3-[(4-methylphenyl)sulfonylamino]propylidene]cyclohexyl]oxymethyl]-2-oxo-1,8-diazaspiro[5.5]undecane-8-carboxylate.
| Compound Name | tert-butyl 7-[[4-[3-[(4-methylphenyl)sulfonylamino]propylidene]cyclohexyl]oxymethyl]-2-oxo-1,8-diazaspiro[5.5]undecane-8-carboxylate |
|---|---|
| PubChem CID | 170605775 |
| Molecular Formula | C31H47N3O6S |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | tert-butyl 7-[[4-[3-[(4-methylphenyl)sulfonylamino]propylidene]cyclohexyl]oxymethyl]-2-oxo-1,8-diazaspiro[5.5]undecane-8-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)NCCC=C2CCC(OCC3N(C(=O)OC(C)(C)C)CCCC34CCCC(=O)N4)CC2)cc1 |
| InChI | InChI=1S/C31H47N3O6S/c1-23-10-16-26(17-11-23)41(37,38)32-20-6-8-24-12-14-25(15-13-24)39-22-27-31(18-5-9-28(35)33-31)19-7-21-34(27)29(36)40-30(2,3)4/h8,10-11,16-17,25,27,32H,5-7,9,12-15,18-22H2,1-4H3,(H,33,35)/b24-8- |
| InChIKey | RXNOEMOIWDVNRE-GYRAYZOKSA-N |
| XLogP | 4.99 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|