C26H41N3O5 — CID 170774875
tert-butyl (2R,3R)-3-[2-(methylamino)ethyl]-3-nitro-2-[(4-phenylcyclohexyl)oxymethyl]piperidine-1-carboxylate (PubChem CID 170774875) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-[2-(methylamino)ethyl]-3-nitro-2-[(4-phenylcyclohexyl)oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-[2-(methylamino)ethyl]-3-nitro-2-[(4-phenylcyclohexyl)oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170774875 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | tert-butyl (2R,3R)-3-[2-(methylamino)ethyl]-3-nitro-2-[(4-phenylcyclohexyl)oxymethyl]piperidine-1-carboxylate |
| SMILES | CNCC[C@]1([N+](=O)[O-])CCCN(C(=O)OC(C)(C)C)[C@H]1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H41N3O5/c1-25(2,3)34-24(30)28-18-8-15-26(29(31)32,16-17-27-4)23(28)19-33-22-13-11-21(12-14-22)20-9-6-5-7-10-20/h5-7,9-10,21-23,27H,8,11-19H2,1-4H3/t21?,22?,23-,26+/m0/s1 |
| InChIKey | SQPRXVAUSRPUFK-KCRWFKQWSA-N |
| XLogP | 4.75 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|