C23H35NO6S — CID 142524679
tert-butyl (2S,3R)-3-methylsulfonyloxy-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 142524679) has the molecular formula C23H35NO6S and a molecular weight of 453.60 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-methylsulfonyloxy-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-3-methylsulfonyloxy-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142524679 |
| Molecular Formula | C23H35NO6S |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | tert-butyl (2S,3R)-3-methylsulfonyloxy-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](OS(C)(=O)=O)[C@@H]1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H35NO6S/c1-23(2,3)29-22(25)24-15-14-21(30-31(4,26)27)20(24)16-28-19-12-10-18(11-13-19)17-8-6-5-7-9-17/h5-9,18-21H,10-16H2,1-4H3/t18?,19?,20-,21+/m0/s1 |
| InChIKey | MDXVDYKHDJEVLP-NSKBAKJYSA-N |
| XLogP | 4.08 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|