C26H33NO3 — CID 165003395
benzyl (3S)-3-methyl-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 165003395) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is benzyl (3S)-3-methyl-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (3S)-3-methyl-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 165003395 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | benzyl (3S)-3-methyl-2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H]1CCN(C(=O)OCc2ccccc2)C1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H33NO3/c1-20-16-17-27(26(28)30-18-21-8-4-2-5-9-21)25(20)19-29-24-14-12-23(13-15-24)22-10-6-3-7-11-22/h2-11,20,23-25H,12-19H2,1H3/t20-,23?,24?,25?/m0/s1 |
| InChIKey | LCTXXKVHBUSVRO-MVFMVMQSSA-N |
| XLogP | 5.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |