C28H42N2O5S — CID 170774842
tert-butyl (2R,3R)-3-(ethenylsulfonylamino)-2-[(4-phenylcyclohexyl)oxymethyl]-3-prop-2-enylpiperidine-1-carboxylate (PubChem CID 170774842) has the molecular formula C28H42N2O5S and a molecular weight of 518.72 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-(ethenylsulfonylamino)-2-[(4-phenylcyclohexyl)oxymethyl]-3-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-(ethenylsulfonylamino)-2-[(4-phenylcyclohexyl)oxymethyl]-3-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170774842 |
| Molecular Formula | C28H42N2O5S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | tert-butyl (2R,3R)-3-(ethenylsulfonylamino)-2-[(4-phenylcyclohexyl)oxymethyl]-3-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@]1(NS(=O)(=O)C=C)CCCN(C(=O)OC(C)(C)C)[C@H]1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C28H42N2O5S/c1-6-18-28(29-36(32,33)7-2)19-11-20-30(26(31)35-27(3,4)5)25(28)21-34-24-16-14-23(15-17-24)22-12-9-8-10-13-22/h6-10,12-13,23-25,29H,1-2,11,14-21H2,3-5H3/t23?,24?,25-,28-/m0/s1 |
| InChIKey | RKSPVRWEHNRXIN-KXYAPNRYSA-N |
| XLogP | 5.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|