C20H27FN2O6 — CID 95850255
tert-butyl (2R,3R)-2-(4-fluorophenyl)-3-(3-methoxy-3-oxopropyl)-3-nitropiperidine-1-carboxylate (PubChem CID 95850255) has the molecular formula C20H27FN2O6 and a molecular weight of 410.44 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-(4-fluorophenyl)-3-(3-methoxy-3-oxopropyl)-3-nitropiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-2-(4-fluorophenyl)-3-(3-methoxy-3-oxopropyl)-3-nitropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 95850255 |
| Molecular Formula | C20H27FN2O6 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | tert-butyl (2R,3R)-2-(4-fluorophenyl)-3-(3-methoxy-3-oxopropyl)-3-nitropiperidine-1-carboxylate |
| SMILES | COC(=O)CC[C@]1([N+](=O)[O-])CCCN(C(=O)OC(C)(C)C)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H27FN2O6/c1-19(2,3)29-18(25)22-13-5-11-20(23(26)27,12-10-16(24)28-4)17(22)14-6-8-15(21)9-7-14/h6-9,17H,5,10-13H2,1-4H3/t17-,20-/m1/s1 |
| InChIKey | FNRBYCFAKIUMOT-YLJYHZDGSA-N |
| XLogP | 3.87 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|