C16H21FN2O4 — CID 46951293
tert-butyl (2S,3R)-2-(4-fluorophenyl)-3-nitropiperidine-1-carboxylate (PubChem CID 46951293) has the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-(4-fluorophenyl)-3-nitropiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-(4-fluorophenyl)-3-nitropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 46951293 |
| Molecular Formula | C16H21FN2O4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl (2S,3R)-2-(4-fluorophenyl)-3-nitropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]([N+](=O)[O-])[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN2O4/c1-16(2,3)23-15(20)18-10-4-5-13(19(21)22)14(18)11-6-8-12(17)9-7-11/h6-9,13-14H,4-5,10H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | QAPYFCVBMZVWHR-KGLIPLIRSA-N |
| XLogP | 3.54 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|