C19H28FNO3 — CID 145138549
tert-butyl 2-[[5-fluoro-2-(3-hydroxypropyl)phenyl]methyl]pyrrolidine-1-carboxylate (PubChem CID 145138549) has the molecular formula C19H28FNO3 and a molecular weight of 337.44 g/mol. Its IUPAC name is tert-butyl 2-[[5-fluoro-2-(3-hydroxypropyl)phenyl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[5-fluoro-2-(3-hydroxypropyl)phenyl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145138549 |
| Molecular Formula | C19H28FNO3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | tert-butyl 2-[[5-fluoro-2-(3-hydroxypropyl)phenyl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1Cc1cc(F)ccc1CCCO |
| InChI | InChI=1S/C19H28FNO3/c1-19(2,3)24-18(23)21-10-4-7-17(21)13-15-12-16(20)9-8-14(15)6-5-11-22/h8-9,12,17,22H,4-7,10-11,13H2,1-3H3 |
| InChIKey | DIICZMGOXSNSDT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |