C23H24N2O4S — CID 11281702
tert-butyl 3-[3-[(4-methylphenyl)sulfonylamino]prop-1-ynyl]indole-1-carboxylate (PubChem CID 11281702) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is tert-butyl 3-[3-[(4-methylphenyl)sulfonylamino]prop-1-ynyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[(4-methylphenyl)sulfonylamino]prop-1-ynyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 11281702 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | tert-butyl 3-[3-[(4-methylphenyl)sulfonylamino]prop-1-ynyl]indole-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)NCC#Cc2cn(C(=O)OC(C)(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H24N2O4S/c1-17-11-13-19(14-12-17)30(27,28)24-15-7-8-18-16-25(22(26)29-23(2,3)4)21-10-6-5-9-20(18)21/h5-6,9-14,16,24H,15H2,1-4H3 |
| InChIKey | NMVZHAWMKJDDQD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|