About tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate
tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate (PubChem CID 101490574) has the molecular formula C31H32N4O4S
and a molecular weight of 556.69 g/mol. Its IUPAC name is tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate |
| PubChem CID | 101490574 |
| Molecular Formula | C31H32N4O4S |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)C(Cc2cn(Cc3ccccc3)nn2)c2cn(C(=O)OC(C)(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C31H32N4O4S/c1-22-14-16-25(17-15-22)40(37,38)29(18-24-20-34(33-32-24)19-23-10-6-5-7-11-23)27-21-35(30(36)39-31(2,3)4)28-13-9-8-12-26(27)28/h5-17,20-21,29H,18-19H2,1-4H3 |
| InChIKey | NHLYFZUUJTXLJK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 96.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate?
The IUPAC name of tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate (CID 101490574) is tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate?
The canonical SMILES for tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate is Cc1ccc(S(=O)(=O)C(Cc2cn(Cc3ccccc3)nn2)c2cn(C(=O)OC(C)(C)C)c3ccccc23)cc1.
What is the InChIKey of tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate?
The InChIKey is NHLYFZUUJTXLJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H32N4O4S/c1-22-14-16-25(17-15-22)40(37,38)29(18-24-20-34(33-32-24)19-23-10-6-5-7-11-23)27-21-35(30(36)39-31(2,3)4)28-13-9-8-12-26(27)28/h5-17,20-21,29H,18-19H2,1-4H3.
What are the key properties of tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate?
tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate has a molecular weight of 556.69 g/mol, XLogP of 6.13, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[2-(1-benzyltriazol-4-yl)-1-(4-methylphenyl)sulfonylethyl]indole-1-carboxylate is sourced from PubChem (CID 101490574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).