C27H27N3O2 — CID 90047737
2-[4-[4-[2-(1-benzyltriazol-4-yl)ethyl]phenyl]phenyl]-2-methylpropanoic acid (PubChem CID 90047737) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[4-[4-[2-(1-benzyltriazol-4-yl)ethyl]phenyl]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[4-[2-(1-benzyltriazol-4-yl)ethyl]phenyl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 90047737 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-[4-[4-[2-(1-benzyltriazol-4-yl)ethyl]phenyl]phenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1ccc(-c2ccc(CCc3cn(Cc4ccccc4)nn3)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O2/c1-27(2,26(31)32)24-15-13-23(14-16-24)22-11-8-20(9-12-22)10-17-25-19-30(29-28-25)18-21-6-4-3-5-7-21/h3-9,11-16,19H,10,17-18H2,1-2H3,(H,31,32) |
| InChIKey | PYBIPDQDYOERDG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |